C19H15O5P — CID 11428171
5-diphenoxyphosphoryl-1,3-benzodioxole (PubChem CID 11428171) has the molecular formula C19H15O5P and a molecular weight of 354.30 g/mol. Its IUPAC name is 5-diphenoxyphosphoryl-1,3-benzodioxole.
| Compound Name | 5-diphenoxyphosphoryl-1,3-benzodioxole |
|---|---|
| PubChem CID | 11428171 |
| Molecular Formula | C19H15O5P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-diphenoxyphosphoryl-1,3-benzodioxole |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15O5P/c20-25(23-15-7-3-1-4-8-15,24-16-9-5-2-6-10-16)17-11-12-18-19(13-17)22-14-21-18/h1-13H,14H2 |
| InChIKey | VIEMBAAFFJSPMY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|