C19H24NO5P — CID 168847346
(2R)-1-(1,3-benzodioxol-5-yl)-N-[methoxymethyl(phenoxy)phosphoryl]-N-methylpropan-2-amine (PubChem CID 168847346) has the molecular formula C19H24NO5P and a molecular weight of 377.38 g/mol. Its IUPAC name is (2R)-1-(1,3-benzodioxol-5-yl)-N-[methoxymethyl(phenoxy)phosphoryl]-N-methylpropan-2-amine.
| Compound Name | (2R)-1-(1,3-benzodioxol-5-yl)-N-[methoxymethyl(phenoxy)phosphoryl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 168847346 |
| Molecular Formula | C19H24NO5P |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2R)-1-(1,3-benzodioxol-5-yl)-N-[methoxymethyl(phenoxy)phosphoryl]-N-methylpropan-2-amine |
| SMILES | COCP(=O)(Oc1ccccc1)N(C)[C@H](C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H24NO5P/c1-15(11-16-9-10-18-19(12-16)24-13-23-18)20(2)26(21,14-22-3)25-17-7-5-4-6-8-17/h4-10,12,15H,11,13-14H2,1-3H3/t15-,26?/m1/s1 |
| InChIKey | AZNWONOAJZREEI-GJNAARLKSA-N |
| XLogP | 4.15 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|