C15H16NO4P — CID 11860448
N-[methyl(phenoxy)phosphoryl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 11860448) has the molecular formula C15H16NO4P and a molecular weight of 305.27 g/mol. Its IUPAC name is N-[methyl(phenoxy)phosphoryl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[methyl(phenoxy)phosphoryl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 11860448 |
| Molecular Formula | C15H16NO4P |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[methyl(phenoxy)phosphoryl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | C[P@](=O)(Nc1ccc2c(c1)OCCO2)Oc1ccccc1 |
| InChI | InChI=1S/C15H16NO4P/c1-21(17,20-13-5-3-2-4-6-13)16-12-7-8-14-15(11-12)19-10-9-18-14/h2-8,11H,9-10H2,1H3,(H,16,17)/t21-/m1/s1 |
| InChIKey | HFMXIJIQKSPMHT-OAQYLSRUSA-N |
| XLogP | 3.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|