C17H19NO3 — CID 60680266
N-(2-phenoxyethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 60680266) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-(2-phenoxyethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 60680266 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2-phenoxyethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | c1ccc(OCCNc2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-2-5-15(6-3-1)19-12-9-18-14-7-8-16-17(13-14)21-11-4-10-20-16/h1-3,5-8,13,18H,4,9-12H2 |
| InChIKey | SFHQDMVDEBJEKX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|