C19H21NO4S — CID 32513261
(2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-phenoxyethylsulfanyl)propanamide (PubChem CID 32513261) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-phenoxyethylsulfanyl)propanamide.
| Compound Name | (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-phenoxyethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 32513261 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-phenoxyethylsulfanyl)propanamide |
| SMILES | C[C@@H](SCCOc1ccccc1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H21NO4S/c1-14(25-12-11-22-16-5-3-2-4-6-16)19(21)20-15-7-8-17-18(13-15)24-10-9-23-17/h2-8,13-14H,9-12H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | GRGGRTXVOWFKBZ-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|