C22H21O4P — CID 134884593
(1S,2S)-1-(1,3-benzodioxol-5-yl)-2-diphenylphosphorylpropan-1-ol (PubChem CID 134884593) has the molecular formula C22H21O4P and a molecular weight of 380.38 g/mol. Its IUPAC name is (1S,2S)-1-(1,3-benzodioxol-5-yl)-2-diphenylphosphorylpropan-1-ol.
| Compound Name | (1S,2S)-1-(1,3-benzodioxol-5-yl)-2-diphenylphosphorylpropan-1-ol |
|---|---|
| PubChem CID | 134884593 |
| Molecular Formula | C22H21O4P |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (1S,2S)-1-(1,3-benzodioxol-5-yl)-2-diphenylphosphorylpropan-1-ol |
| SMILES | C[C@@H]([C@@H](O)c1ccc2c(c1)OCO2)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21O4P/c1-16(22(23)17-12-13-20-21(14-17)26-15-25-20)27(24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-14,16,22-23H,15H2,1H3/t16-,22+/m0/s1 |
| InChIKey | MSZOYVQTTLRNNE-KSFYIVLOSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|