C34H36Cl2N3O6P — CID 99680855
benzyl (2S)-3-[4-[[bis(2-chloroethyl)amino-phenoxyphosphoryl]amino]phenyl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 99680855) has the molecular formula C34H36Cl2N3O6P and a molecular weight of 684.56 g/mol. Its IUPAC name is benzyl (2S)-3-[4-[[bis(2-chloroethyl)amino-phenoxyphosphoryl]amino]phenyl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2S)-3-[4-[[bis(2-chloroethyl)amino-phenoxyphosphoryl]amino]phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 99680855 |
| Molecular Formula | C34H36Cl2N3O6P |
| Molecular Weight | 684.56 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | benzyl (2S)-3-[4-[[bis(2-chloroethyl)amino-phenoxyphosphoryl]amino]phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@@H](Cc1ccc(N[P@@](=O)(Oc2ccccc2)N(CCCl)CCCl)cc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H36Cl2N3O6P/c35-20-22-39(23-21-36)46(42,45-31-14-8-3-9-15-31)38-30-18-16-27(17-19-30)24-32(33(40)43-25-28-10-4-1-5-11-28)37-34(41)44-26-29-12-6-2-7-13-29/h1-19,32H,20-26H2,(H,37,41)(H,38,42)/t32-,46+/m0/s1 |
| InChIKey | GZYPHXQVUHOCPK-FLQHDMJBSA-N |
| XLogP | 7.65 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.56 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|