C25H33Cl2N3O4 — CID 135362562
1,3-bis(2-chloroethyl)-1-nitrosourea;(8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 135362562) has the molecular formula C25H33Cl2N3O4 and a molecular weight of 510.46 g/mol. Its IUPAC name is 1,3-bis(2-chloroethyl)-1-nitrosourea;(8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 1,3-bis(2-chloroethyl)-1-nitrosourea;(8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 135362562 |
| Molecular Formula | C25H33Cl2N3O4 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 1,3-bis(2-chloroethyl)-1-nitrosourea;(8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12.O=NN(CCCl)C(=O)NCCCl |
| InChI | InChI=1S/C20H24O2.C5H9Cl2N3O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19;6-1-3-8-5(11)10(9-12)4-2-7/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3;1-4H2,(H,8,11)/t14-,15-,16-,19+,20-;/m0./s1 |
| InChIKey | IVRQGBIHXUQHKV-YFDMJGHBSA-N |
| XLogP | 5.19 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|