C20H23FO2 — CID 139675776
(8R,9S,10R,13S,14S)-12-fluoro-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 139675776) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-12-fluoro-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-12-fluoro-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 139675776 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (8R,9S,10R,13S,14S)-12-fluoro-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C[C@@H]2[C@H](CC(F)[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C20H23FO2/c1-11-8-13-14-4-5-18(23)20(14,3)17(21)10-16(13)19(2)7-6-12(22)9-15(11)19/h6-7,9,13-14,16-17H,1,4-5,8,10H2,2-3H3/t13-,14-,16-,17?,19-,20+/m0/s1 |
| InChIKey | AQOAIPAOHWVENA-WGNFWURHSA-N |
| XLogP | 3.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |