C20H24O2 — CID 154812408
16,16-dideuterio-6-(dideuterio(113C)methylidene)-10,13-dimethyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 154812408) has the molecular formula C20H24O2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 16,16-dideuterio-6-(dideuterio(113C)methylidene)-10,13-dimethyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 16,16-dideuterio-6-(dideuterio(113C)methylidene)-10,13-dimethyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 154812408 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 16,16-dideuterio-6-(dideuterio(113C)methylidene)-10,13-dimethyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [2H][13C]([2H])=C1CC2C(CCC3(C)C(=O)C([2H])([2H])CC23)C2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/i1+1D2,5D2 |
| InChIKey | BFYIZQONLCFLEV-LDDIBDQASA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |