C7H16ClN5O6S2 — CID 88684492
1-(2-chloroethyl)-1-nitroso-3-[2-(2-sulfamoylethylsulfamoyl)ethyl]urea (PubChem CID 88684492) has the molecular formula C7H16ClN5O6S2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-[2-(2-sulfamoylethylsulfamoyl)ethyl]urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-[2-(2-sulfamoylethylsulfamoyl)ethyl]urea |
|---|---|
| PubChem CID | 88684492 |
| Molecular Formula | C7H16ClN5O6S2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-[2-(2-sulfamoylethylsulfamoyl)ethyl]urea |
| SMILES | NS(=O)(=O)CCNS(=O)(=O)CCNC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C7H16ClN5O6S2/c8-1-4-13(12-15)7(14)10-2-6-21(18,19)11-3-5-20(9,16)17/h11H,1-6H2,(H,10,14)(H2,9,16,17) |
| InChIKey | CDKUMJRKCFEMQQ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|