C4H13N3O4S2 — CID 43552164
2-amino-N-(2-sulfamoylethyl)ethanesulfonamide (PubChem CID 43552164) has the molecular formula C4H13N3O4S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-amino-N-(2-sulfamoylethyl)ethanesulfonamide.
| Compound Name | 2-amino-N-(2-sulfamoylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 43552164 |
| Molecular Formula | C4H13N3O4S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-amino-N-(2-sulfamoylethyl)ethanesulfonamide |
| SMILES | NCCS(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C4H13N3O4S2/c5-1-3-13(10,11)7-2-4-12(6,8)9/h7H,1-5H2,(H2,6,8,9) |
| InChIKey | GDCDTCSVQJFJJG-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |