C11H21N3O7 — CID 88790242
1-butyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 88790242) has the molecular formula C11H21N3O7 and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-butyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-butyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 88790242 |
| Molecular Formula | C11H21N3O7 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-butyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | CCCCN(N=O)C(=O)N[C@@]1(O)CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H21N3O7/c1-2-3-4-14(13-20)10(18)12-11(19)6-21-7(5-15)8(16)9(11)17/h7-9,15-17,19H,2-6H2,1H3,(H,12,18)/t7-,8-,9+,11-/m1/s1 |
| InChIKey | SPQYISYFPIFGGX-SDNRWEOFSA-N |
| XLogP | -1.72 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|