C9H17ClN2O6 — CID 70600770
1-(2-chloroethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 70600770) has the molecular formula C9H17ClN2O6 and a molecular weight of 284.70 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 70600770 |
| Molecular Formula | C9H17ClN2O6 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | O=C(NCCCl)N[C@@]1(O)CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17ClN2O6/c10-1-2-11-8(16)12-9(17)4-18-5(3-13)6(14)7(9)15/h5-7,13-15,17H,1-4H2,(H2,11,12,16)/t5-,6-,7+,9-/m1/s1 |
| InChIKey | FCURCQMGEXWXQI-JAGXHNFQSA-N |
| XLogP | -2.67 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|