C11H24O4Si — CID 56997357
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 56997357) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 56997357 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)[C@]1(O)CO[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C11H24O4Si/c1-10(2,3)16(4,5)11(14)7-15-8(6-12)9(11)13/h8-9,12-14H,6-7H2,1-5H3/t8-,9-,11-/m1/s1 |
| InChIKey | QOAFZJFOVXRZDH-FXPVBKGRSA-N |
| XLogP | 0.52 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|