C7H10O4 — CID 91145820
4-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91145820) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 4-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 4-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91145820 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#CC1(O)COC(CO)C1O |
| InChI | InChI=1S/C7H10O4/c1-2-7(10)4-11-5(3-8)6(7)9/h1,5-6,8-10H,3-4H2 |
| InChIKey | NJDZZGXAVBJNQH-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|