C6H11ClO3 — CID 150843883
(2R,3R)-4-chloro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 150843883) has the molecular formula C6H11ClO3 and a molecular weight of 166.60 g/mol. Its IUPAC name is (2R,3R)-4-chloro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R)-4-chloro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 150843883 |
| Molecular Formula | C6H11ClO3 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (2R,3R)-4-chloro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CC1(Cl)CO[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C6H11ClO3/c1-6(7)3-10-4(2-8)5(6)9/h4-5,8-9H,2-3H2,1H3/t4-,5-,6?/m1/s1 |
| InChIKey | KOOSLEPLLJEBLY-QYRBDRAASA-N |
| XLogP | -0.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|