C15H20O6 — CID 90706898
(2S,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(4-prop-2-enylphenyl)oxane-2,3,4,5-tetrol (PubChem CID 90706898) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(4-prop-2-enylphenyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(4-prop-2-enylphenyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 90706898 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(4-prop-2-enylphenyl)oxane-2,3,4,5-tetrol |
| SMILES | C=CCc1ccc([C@]2(O)[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H20O6/c1-2-3-9-4-6-10(7-5-9)15(20)13(18)12(17)11(8-16)21-14(15)19/h2,4-7,11-14,16-20H,1,3,8H2/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | SZTNOGJVVJHERF-NIFZNCRKSA-N |
| XLogP | -0.97 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|