C24H31NO7 — CID 69278396
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[4-[(4-hydroxypiperidin-1-yl)-phenylmethyl]phenyl]oxane-2,3,4,5-tetrol (PubChem CID 69278396) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[4-[(4-hydroxypiperidin-1-yl)-phenylmethyl]phenyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[4-[(4-hydroxypiperidin-1-yl)-phenylmethyl]phenyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69278396 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[4-[(4-hydroxypiperidin-1-yl)-phenylmethyl]phenyl]oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@H](O)[C@@](O)(c2ccc(C(c3ccccc3)N3CCC(O)CC3)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H31NO7/c26-14-19-21(28)22(29)24(31,23(30)32-19)17-8-6-16(7-9-17)20(15-4-2-1-3-5-15)25-12-10-18(27)11-13-25/h1-9,18-23,26-31H,10-14H2/t19-,20?,21-,22+,23-,24-/m1/s1 |
| InChIKey | MQLTWBIZEOONMF-XOTJWQDKSA-N |
| XLogP | -0.15 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |