C16H17ClO6 — CID 57171811
(2S,3R,4R,5S,6R)-5-chloro-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol (PubChem CID 57171811) has the molecular formula C16H17ClO6 and a molecular weight of 340.76 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-5-chloro-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5S,6R)-5-chloro-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57171811 |
| Molecular Formula | C16H17ClO6 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (2S,3R,4R,5S,6R)-5-chloro-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@](O)(c2cccc3ccccc23)[C@H](O)[C@@H](O)[C@]1(O)Cl |
| InChI | InChI=1S/C16H17ClO6/c17-15(21)12(8-18)23-16(22,14(20)13(15)19)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-14,18-22H,8H2/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | HAEKIMBVAKEPNF-SUJAAXHWSA-N |
| XLogP | 0.03 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|