C18H21NO8 — CID 21117511
[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-6-naphthalen-1-yloxan-2-yl] N-methylcarbamate (PubChem CID 21117511) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-6-naphthalen-1-yloxan-2-yl] N-methylcarbamate.
| Compound Name | [(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-6-naphthalen-1-yloxan-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 21117511 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)-6-naphthalen-1-yloxan-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@]1(CO)O[C@](O)(c2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21NO8/c1-19-16(24)26-17(9-20)14(22)13(21)15(23)18(25,27-17)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13-15,20-23,25H,9H2,1H3,(H,19,24)/t13-,14-,15+,17+,18+/m0/s1 |
| InChIKey | COQQLZIQAVQBDX-KCEFYPGHSA-N |
| XLogP | -0.86 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |