C10H12INO4 — CID 91505027
(2R,3S,4R)-2-(hydroxymethyl)-5-(2-iodo-3-pyridinyl)oxolane-3,4-diol (PubChem CID 91505027) has the molecular formula C10H12INO4 and a molecular weight of 337.11 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-(2-iodo-3-pyridinyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(2-iodo-3-pyridinyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91505027 |
| Molecular Formula | C10H12INO4 |
| Molecular Weight | 337.11 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(2-iodo-3-pyridinyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(c2cccnc2I)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12INO4/c11-10-5(2-1-3-12-10)9-8(15)7(14)6(4-13)16-9/h1-3,6-9,13-15H,4H2/t6-,7-,8-,9?/m1/s1 |
| InChIKey | OWIZLXDXHRKVEE-BYBOBHAWSA-N |
| XLogP | -0.16 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.11 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|