C11H11F5N2O4 — CID 71732375
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]oxolane-3,4-diol (PubChem CID 71732375) has the molecular formula C11H11F5N2O4 and a molecular weight of 330.21 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 71732375 |
| Molecular Formula | C11H11F5N2O4 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2nccc(C(F)(F)C(F)(F)F)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H11F5N2O4/c12-10(13,11(14,15)16)5-1-2-17-9(18-5)8-7(21)6(20)4(3-19)22-8/h1-2,4,6-8,19-21H,3H2/t4-,6-,7-,8-/m1/s1 |
| InChIKey | QYYQVXFAPTZQST-XVFCMESISA-N |
| XLogP | 0.28 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|