C9H15N3O4 — CID 10609441
(2S,3R,4S,5R)-2-(1,5-dimethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10609441) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(1,5-dimethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(1,5-dimethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10609441 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (2S,3R,4S,5R)-2-(1,5-dimethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cc1nc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)nn1C |
| InChI | InChI=1S/C9H15N3O4/c1-4-10-9(11-12(4)2)8-7(15)6(14)5(3-13)16-8/h5-8,13-15H,3H2,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | PVFRRXADCDNVOW-WCTZXXKLSA-N |
| XLogP | -1.72 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |