C11H14N4O6 — CID 123727350
3-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione (PubChem CID 123727350) has the molecular formula C11H14N4O6 and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 3-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 123727350 |
| Molecular Formula | C11H14N4O6 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
| SMILES | Cn1nc(C2O[C@H](CO)[C@@H](O)[C@H]2O)c2[nH]c(=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H14N4O6/c1-15-6-4(12-11(20)13-10(6)19)5(14-15)9-8(18)7(17)3(2-16)21-9/h3,7-9,16-18H,2H2,1H3,(H2,12,13,19,20)/t3-,7-,8-,9?/m1/s1 |
| InChIKey | NDXICQYHNDCKDX-NPHNYOHOSA-N |
| XLogP | -2.90 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |