C12H14N2O5 — CID 118004756
5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-ethynyl-3-methyl-1H-pyrazin-2-one (PubChem CID 118004756) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-ethynyl-3-methyl-1H-pyrazin-2-one.
| Compound Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-ethynyl-3-methyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 118004756 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-ethynyl-3-methyl-1H-pyrazin-2-one |
| SMILES | C#Cc1[nH]c(=O)c(C)nc1[C@@H]1O[C@H](CO)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H14N2O5/c1-3-6-8(13-5(2)12(18)14-6)11-10(17)9(16)7(4-15)19-11/h1,7,9-11,15-17H,4H2,2H3,(H,14,18)/t7-,9?,10+,11+/m1/s1 |
| InChIKey | DFTDMYXKBZMNMV-FFFOGLNVSA-N |
| XLogP | -1.79 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|