C12H16N2O6 — CID 175419624
5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione;prop-1-yne (PubChem CID 175419624) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione;prop-1-yne.
| Compound Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione;prop-1-yne |
|---|---|
| PubChem CID | 175419624 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione;prop-1-yne |
| SMILES | C#CC.O=c1[nH]cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C3H4/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15;1-3-2/h1,4-7,12-14H,2H2,(H2,10,11,15,16);1H,2H3/t4-,5-,6-,7+;/m1./s1 |
| InChIKey | JAVOQOFHRZMWJZ-MDTBIHKOSA-N |
| XLogP | -2.14 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|