C10H14N2O6 — CID 70685906
5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 70685906) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70685906 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O6/c1-10(17)6(14)5(3-13)18-7(10)4-2-11-9(16)12-8(4)15/h2,5-7,13-14,17H,3H2,1H3,(H2,11,12,15,16)/t5-,6-,7+,10-/m1/s1 |
| InChIKey | WQOPYKXGDGQVCK-QGOVLLJGSA-N |
| XLogP | -2.39 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |