C16H15F5N4O5 — CID 87983801
5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]-1H-pyrimidin-2-one (PubChem CID 87983801) has the molecular formula C16H15F5N4O5 and a molecular weight of 438.31 g/mol. Its IUPAC name is 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]-1H-pyrimidin-2-one.
| Compound Name | 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 87983801 |
| Molecular Formula | C16H15F5N4O5 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 5-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-[2-(2,3,4,5,6-pentafluorophenyl)hydrazinyl]-1H-pyrimidin-2-one |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1cnc(=O)[nH]c1NNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H15F5N4O5/c1-16(29)12(27)5(3-26)30-13(16)4-2-22-15(28)23-14(4)25-24-11-9(20)7(18)6(17)8(19)10(11)21/h2,5,12-13,24,26-27,29H,3H2,1H3,(H2,22,23,25,28)/t5-,12-,13+,16-/m1/s1 |
| InChIKey | RCGIFLQJEXWUDG-FNBQXKGDSA-N |
| XLogP | 0.45 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|