About 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one
5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one (PubChem CID 144823637) has the molecular formula C11H16N2O5
and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one |
| PubChem CID | 144823637 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one |
| SMILES | COC1C(O)[C@@H](CO)O[C@H]1c1cnc(=O)[nH]c1C |
| InChI | InChI=1S/C11H16N2O5/c1-5-6(3-12-11(16)13-5)9-10(17-2)8(15)7(4-14)18-9/h3,7-10,14-15H,4H2,1-2H3,(H,12,13,16)/t7-,8?,9+,10?/m1/s1 |
| InChIKey | HCZOMFTVNJWYQT-RJQCTPFPSA-N |
| XLogP | -1.11 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one?
The IUPAC name of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one (CID 144823637) is 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one.
What is the SMILES notation for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one?
The canonical SMILES for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one is COC1C(O)[C@@H](CO)O[C@H]1c1cnc(=O)[nH]c1C.
What is the InChIKey of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one?
The InChIKey is HCZOMFTVNJWYQT-RJQCTPFPSA-N. The full InChI is InChI=1S/C11H16N2O5/c1-5-6(3-12-11(16)13-5)9-10(17-2)8(15)7(4-14)18-9/h3,7-10,14-15H,4H2,1-2H3,(H,12,13,16)/t7-,8?,9+,10?/m1/s1.
What are the key properties of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one?
5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one has a molecular weight of 256.26 g/mol, XLogP of -1.11, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-methyl-1H-pyrimidin-2-one is sourced from PubChem (CID 144823637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).