C10H13FN2O5 — CID 123136021
6-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyrazin-2-one (PubChem CID 123136021) has the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. Its IUPAC name is 6-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyrazin-2-one.
| Compound Name | 6-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 123136021 |
| Molecular Formula | C10H13FN2O5 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyrazin-2-one |
| SMILES | COC1C(c2ncc(=O)[nH]c2F)OC(CO)C1O |
| InChI | InChI=1S/C10H13FN2O5/c1-17-9-7(16)4(3-14)18-8(9)6-10(11)13-5(15)2-12-6/h2,4,7-9,14,16H,3H2,1H3,(H,13,15) |
| InChIKey | ORGCZOZSZLBACT-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |