C12H16FNO5 — CID 123460212
4-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3-methyl-1H-pyridin-2-one (PubChem CID 123460212) has the molecular formula C12H16FNO5 and a molecular weight of 273.26 g/mol. Its IUPAC name is 4-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3-methyl-1H-pyridin-2-one.
| Compound Name | 4-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123460212 |
| Molecular Formula | C12H16FNO5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-fluoro-5-[4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3-methyl-1H-pyridin-2-one |
| SMILES | COC1C(c2c[nH]c(=O)c(C)c2F)OC(CO)C1O |
| InChI | InChI=1S/C12H16FNO5/c1-5-8(13)6(3-14-12(5)17)10-11(18-2)9(16)7(4-15)19-10/h3,7,9-11,15-16H,4H2,1-2H3,(H,14,17) |
| InChIKey | ILPHCHPPXNGRDF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |