C11H13F2NO5 — CID 123736213
5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6-difluoro-3-methyl-1H-pyridin-2-one (PubChem CID 123736213) has the molecular formula C11H13F2NO5 and a molecular weight of 277.22 g/mol. Its IUPAC name is 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6-difluoro-3-methyl-1H-pyridin-2-one.
| Compound Name | 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6-difluoro-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123736213 |
| Molecular Formula | C11H13F2NO5 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6-difluoro-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1c(F)c(C2OC(CO)C(O)C2O)c(F)[nH]c1=O |
| InChI | InChI=1S/C11H13F2NO5/c1-3-6(12)5(10(13)14-11(3)18)9-8(17)7(16)4(2-15)19-9/h4,7-9,15-17H,2H2,1H3,(H,14,18) |
| InChIKey | OMWBKHOVKSEUIK-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|