C11H14FNO5 — CID 118004766
5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-3-methyl-1H-pyridin-2-one (PubChem CID 118004766) has the molecular formula C11H14FNO5 and a molecular weight of 259.23 g/mol. Its IUPAC name is 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-3-methyl-1H-pyridin-2-one.
| Compound Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118004766 |
| Molecular Formula | C11H14FNO5 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc([C@@H]2O[C@H](CO)C(O)[C@@H]2O)c(F)[nH]c1=O |
| InChI | InChI=1S/C11H14FNO5/c1-4-2-5(10(12)13-11(4)17)9-8(16)7(15)6(3-14)18-9/h2,6-9,14-16H,3H2,1H3,(H,13,17)/t6-,7?,8+,9+/m1/s1 |
| InChIKey | PFORLHRRKPAUTE-FAZFRDGJSA-N |
| XLogP | -1.02 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|