C12H15N3O5 — CID 135910196
7-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 135910196) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 7-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 7-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135910196 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 7-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1ccc2c(=O)[nH]cnn12 |
| InChI | InChI=1S/C12H15N3O5/c1-12(19)9(17)8(4-16)20-10(12)6-2-3-7-11(18)13-5-14-15(6)7/h2-3,5,8-10,16-17,19H,4H2,1H3,(H,13,14,18)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | NWVQUHDGAFUPCN-MWGHHZFTSA-N |
| XLogP | -1.43 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |