C13H20FN3O5 — CID 151462366
5-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 151462366) has the molecular formula C13H20FN3O5 and a molecular weight of 317.32 g/mol. Its IUPAC name is 5-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 151462366 |
| Molecular Formula | C13H20FN3O5 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)CN(O)[C@H]1[C@H](F)[C@H](c2c[nH]c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C13H20FN3O5/c1-6(2)4-17(21)10-8(5-18)22-11(9(10)14)7-3-15-13(20)16-12(7)19/h3,6,8-11,18,21H,4-5H2,1-2H3,(H2,15,16,19,20)/t8-,9+,10-,11+/m1/s1 |
| InChIKey | PISQZQZREVCNGD-YTWAJWBKSA-N |
| XLogP | -0.45 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|