C29H38FN3O5Si — CID 150302943
5-[(2S,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 150302943) has the molecular formula C29H38FN3O5Si and a molecular weight of 555.72 g/mol. Its IUPAC name is 5-[(2S,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2S,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150302943 |
| Molecular Formula | C29H38FN3O5Si |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 5-[(2S,3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-[hydroxy(2-methylpropyl)amino]oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)CN(O)[C@H]1[C@H](F)[C@H](c2c[nH]c(=O)[nH]c2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H38FN3O5Si/c1-19(2)17-33(36)25-23(38-26(24(25)30)22-16-31-28(35)32-27(22)34)18-37-39(29(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,19,23-26,36H,17-18H2,1-5H3,(H2,31,32,34,35)/t23-,24+,25-,26+/m1/s1 |
| InChIKey | GJZNVXMDTLCRCS-ZJSPYRCASA-N |
| XLogP | 3.13 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|