C25H30F2N2O3Si — CID 89262198
1-[5-[2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-1H-imidazol-2-yl]-2,2-difluoroethanone (PubChem CID 89262198) has the molecular formula C25H30F2N2O3Si and a molecular weight of 472.61 g/mol. Its IUPAC name is 1-[5-[2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-1H-imidazol-2-yl]-2,2-difluoroethanone.
| Compound Name | 1-[5-[2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-1H-imidazol-2-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 89262198 |
| Molecular Formula | C25H30F2N2O3Si |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-[5-[2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-1H-imidazol-2-yl]-2,2-difluoroethanone |
| SMILES | CCOC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1cnc(C(=O)C(F)F)[nH]1 |
| InChI | InChI=1S/C25H30F2N2O3Si/c1-5-31-21(20-16-28-24(29-20)22(30)23(26)27)17-32-33(25(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-16,21,23H,5,17H2,1-4H3,(H,28,29) |
| InChIKey | PMYMWERLFOKQSR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|