C11H13BrN2O6 — CID 150136599
5-(2-bromoethenyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 150136599) has the molecular formula C11H13BrN2O6 and a molecular weight of 349.14 g/mol. Its IUPAC name is 5-(2-bromoethenyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromoethenyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150136599 |
| Molecular Formula | C11H13BrN2O6 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 5-(2-bromoethenyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(C=CBr)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13BrN2O6/c12-2-1-4-6(13-11(19)14-10(4)18)9-8(17)7(16)5(3-15)20-9/h1-2,5,7-9,15-17H,3H2,(H2,13,14,18,19)/t5-,7-,8+,9+/m1/s1 |
| InChIKey | FCJMTNWKZBIXID-ZLNHGNLKSA-N |
| XLogP | -1.42 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |