C18H19BrN4O4 — CID 131883093
(2R,3S,4R,5R)-2-(2,3-diphenyltetrazol-2-ium-5-yl)-5-(hydroxymethyl)oxolane-3,4-diol bromide (PubChem CID 131883093) has the molecular formula C18H19BrN4O4 and a molecular weight of 435.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2,3-diphenyltetrazol-2-ium-5-yl)-5-(hydroxymethyl)oxolane-3,4-diol bromide.
| Compound Name | (2R,3S,4R,5R)-2-(2,3-diphenyltetrazol-2-ium-5-yl)-5-(hydroxymethyl)oxolane-3,4-diol bromide |
|---|---|
| PubChem CID | 131883093 |
| Molecular Formula | C18H19BrN4O4 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2,3-diphenyltetrazol-2-ium-5-yl)-5-(hydroxymethyl)oxolane-3,4-diol bromide |
| SMILES | OC[C@H]1O[C@H](c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)[C@@H](O)[C@H]1O.[Br-] |
| InChI | InChI=1S/C18H19N4O4.BrH/c23-11-14-15(24)16(25)17(26-14)18-19-21(12-7-3-1-4-8-12)22(20-18)13-9-5-2-6-10-13;/h1-10,14-17,23-25H,11H2;1H/q+1;/p-1/t14-,15+,16+,17+;/m1./s1 |
| InChIKey | WWUKWYKXYNNWSE-UTTFALACSA-M |
| XLogP | -3.30 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|