C19H19N3O4S — CID 171984587
2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 171984587) has the molecular formula C19H19N3O4S and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,5-diphenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,5-diphenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 171984587 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | OC[C@H]1O[C@@H](n2nc(-c3ccccc3)n(-c3ccccc3)c2=S)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19N3O4S/c23-11-14-15(24)16(25)18(26-14)22-19(27)21(13-9-5-2-6-10-13)17(20-22)12-7-3-1-4-8-12/h1-10,14-16,18,23-25H,11H2/t14-,15+,16+,18-/m1/s1 |
| InChIKey | SVNPGXUWIKMULY-MUQADHOPSA-N |
| XLogP | 1.68 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|