C22H20N4O4 — CID 11058553
(2R,3R,4S,5R)-2-(2,6-diphenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11058553) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2,6-diphenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2,6-diphenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11058553 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2,6-diphenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(-c4ccccc4)nc(-c4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H20N4O4/c27-11-15-18(28)19(29)22(30-15)26-12-23-17-16(13-7-3-1-4-8-13)24-20(25-21(17)26)14-9-5-2-6-10-14/h1-10,12,15,18-19,22,27-29H,11H2/t15-,18-,19-,22-/m1/s1 |
| InChIKey | WHEZCNNVYQEHGT-CIVUBGFFSA-N |
| XLogP | 1.77 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |