C16H15BrN4O4 — CID 10949556
(2R,3R,4S,5R)-2-(2-bromo-6-phenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10949556) has the molecular formula C16H15BrN4O4 and a molecular weight of 407.22 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-bromo-6-phenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-bromo-6-phenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10949556 |
| Molecular Formula | C16H15BrN4O4 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-bromo-6-phenylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(-c4ccccc4)nc(Br)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H15BrN4O4/c17-16-19-10(8-4-2-1-3-5-8)11-14(20-16)21(7-18-11)15-13(24)12(23)9(6-22)25-15/h1-5,7,9,12-13,15,22-24H,6H2/t9-,12-,13-,15-/m1/s1 |
| InChIKey | BYORLKIJDVDZDM-QGMIFYJMSA-N |
| XLogP | 0.87 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |