C24H20N4O4 — CID 59035022
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-phenanthren-9-ylpurin-9-yl)oxolane-3,4-diol (PubChem CID 59035022) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-phenanthren-9-ylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-phenanthren-9-ylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59035022 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-phenanthren-9-ylpurin-9-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(-c4cc5ccccc5c5ccccc45)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H20N4O4/c29-10-18-21(30)22(31)24(32-18)28-12-27-20-19(25-11-26-23(20)28)17-9-13-5-1-2-6-14(13)15-7-3-4-8-16(15)17/h1-9,11-12,18,21-22,24,29-31H,10H2/t18-,21-,22-,24-/m1/s1 |
| InChIKey | GOAJEIIVZNFTNG-QMBPOEKNSA-N |
| XLogP | 2.41 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|