C17H15N5O5Se — CID 511853
2-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-1,2-benzoselenazol-3-one (PubChem CID 511853) has the molecular formula C17H15N5O5Se and a molecular weight of 448.30 g/mol. Its IUPAC name is 2-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 511853 |
| Molecular Formula | C17H15N5O5Se |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1-c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H15N5O5Se/c23-5-9-12(24)13(25)17(27-9)21-7-20-11-14(21)18-6-19-15(11)22-16(26)8-3-1-2-4-10(8)28-22/h1-4,6-7,9,12-13,17,23-25H,5H2/t9-,12-,13-,17-/m1/s1 |
| InChIKey | CONHQNUVSZSALQ-DMEFTLKTSA-N |
| XLogP | -1.20 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|