C15H15N5O4 — CID 10336664
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-pyridin-2-ylpurin-9-yl)oxolane-3,4-diol (PubChem CID 10336664) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-pyridin-2-ylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-pyridin-2-ylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10336664 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-pyridin-2-ylpurin-9-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(-c4ccccn4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H15N5O4/c21-5-9-12(22)13(23)15(24-9)20-7-19-11-10(17-6-18-14(11)20)8-3-1-2-4-16-8/h1-4,6-7,9,12-13,15,21-23H,5H2/t9-,12-,13-,15-/m1/s1 |
| InChIKey | KGARCZMCQCLSRS-QGMIFYJMSA-N |
| XLogP | -0.50 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |