C13H14N2O5S — CID 681691
3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-1,3,4-oxadiazole-2-thione (PubChem CID 681691) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 681691 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-1,3,4-oxadiazole-2-thione |
| SMILES | OC[C@H]1O[C@@H](n2nc(-c3ccccc3)oc2=S)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H14N2O5S/c16-6-8-9(17)10(18)12(19-8)15-13(21)20-11(14-15)7-4-2-1-3-5-7/h1-5,8-10,12,16-18H,6H2/t8-,9-,10+,12-/m1/s1 |
| InChIKey | OTNUFIBRIVYITJ-MWGHHZFTSA-N |
| XLogP | 0.48 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|