C14H17N3O5 — CID 24984664
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-[hydroxy(phenyl)methyl]-1,2,4-triazol-1-yl]oxolane-3,4-diol (PubChem CID 24984664) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-[hydroxy(phenyl)methyl]-1,2,4-triazol-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-[hydroxy(phenyl)methyl]-1,2,4-triazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 24984664 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-[hydroxy(phenyl)methyl]-1,2,4-triazol-1-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc(C(O)c3ccccc3)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H17N3O5/c18-6-9-11(20)12(21)14(22-9)17-7-15-13(16-17)10(19)8-4-2-1-3-5-8/h1-5,7,9-12,14,18-21H,6H2/t9-,10?,11-,12-,14-/m1/s1 |
| InChIKey | YCRQMXYXFMTYIW-SLIIGYDMSA-N |
| XLogP | -1.03 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |