C20H21N3O4S — CID 100942361
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 100942361) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 100942361 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-12-7-9-13(10-8-12)18-21-23(19-17(26)16(25)15(11-24)27-19)20(28)22(18)14-5-3-2-4-6-14/h2-10,15-17,19,24-26H,11H2,1H3/t15-,16-,17-,19-/m1/s1 |
| InChIKey | SBEUXELXXBGCNA-YWTNHNAXSA-N |
| XLogP | 1.99 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|