C20H28N4O5S — CID 51696370
N-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[3-(4-methylphenyl)-4-propan-2-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide (PubChem CID 51696370) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[3-(4-methylphenyl)-4-propan-2-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[3-(4-methylphenyl)-4-propan-2-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 51696370 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[3-(4-methylphenyl)-4-propan-2-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](O)[C@H](O)[C@H](CO)O[C@@H]1n1nc(-c2ccc(C)cc2)n(C(C)C)c1=S |
| InChI | InChI=1S/C20H28N4O5S/c1-10(2)23-18(13-7-5-11(3)6-8-13)22-24(20(23)30)19-15(21-12(4)26)17(28)16(27)14(9-25)29-19/h5-8,10,14-17,19,25,27-28H,9H2,1-4H3,(H,21,26)/t14-,15+,16+,17-,19-/m0/s1 |
| InChIKey | VNGSVSLXZFOYFJ-ATIFRJIPSA-N |
| XLogP | 1.09 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|